Melamine-15N3（Cat No.:R010196） is an isotopically labeled form of melamine, where three of its nitrogen atoms are enriched with nitrogen-15 (15N). This enhancement significantly improves its detectability and specificity in analytical methods, particularly useful in studies involving nitrogen tracing and metabolism using techniques such as mass spectrometry and NMR spectroscopy. Melamine is a compound used primarily in the production of plastics, adhesives, and laminates, and it has been scrutinized for its potential toxicity and contamination in food products.
| Catalog Number | R010196 |
| CAS Number | 287476-11-3 |
| Synonyms | 1,3,5-Triazine-2,4,6-tri(amine-15N3); 2,4,6-Tri(amino-15N3)-s-triazine;?Cyanurotriamide-15N3; NSC 2130-15N3; |
| Molecular Formula | C3H6N6 |
| Purity | 95% |
| Storage | Store at -20C |
| IUPAC Name | 1,3,5-triazine-2,4,6-tri(15N3)amine |
| InChI | InChI=1S/C3H6N6/c4-1-7-2(5)9-3(6)8-1/h(H6,4,5,6,7,8,9)/i4+1,5+1,6+1 |
| InChIKey | JDSHMPZPIAZGSV-VMGGCIAMSA-N |
| SMILES | C1(=NC(=NC(=N1)[15NH2])[15NH2])[15NH2] |
