For research use only. Not for therapeutic Use.
Melandrin (Cat No.: I031894) is a naturally occurring compound isolated from the plant Melandrium firmum (Caryophyllaceae). Chemically, it is known as 5-hydroxy-2-[(4-hydroxybenzoyl)amino]benzoic acid. Pharmacological studies have demonstrated that melandrin exhibits analgesic properties, effectively reducing pain responses in animal models. Additionally, it has been observed to induce hypothermia, lowering body temperature. However, it does not display significant anti-inflammatory activity. These findings suggest potential therapeutic applications for melandrin in pain management, though further research is necessary to fully understand its mechanisms and efficacy.
| CAS Number | 110846-17-8 |
| Synonyms | Melandrin |
| Molecular Formula | C14H11NO5 |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | Benzoic acid, 5-hydroxy-2-((4-hydroxybenzoyl)amino)- |
| InChI | InChI=1S/C14H11NO5/c16-9-3-1-8(2-4-9)13(18)15-12-6-5-10(17)7-11(12)14(19)20/h1-7,16-17H,(H,15,18)(H,19,20) |
| InChIKey | ZOKNFJAARIIMMM-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(O)ccc1NC(=O)c2ccc(O)cc2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
