For research use only. Not for therapeutic Use.
Memantine-d6 Hydrochloride(Cat No.:R004426) is a deuterated form of Memantine Hydrochloride, where six hydrogen atoms are replaced with deuterium. This isotopic labeling enhances its chemical stability and is crucial for pharmacokinetic and metabolic studies of Memantine, a medication used primarily to treat moderate to severe Alzheimer’s disease. By improving the precision of analytical detection methods such as mass spectrometry and NMR spectroscopy, Memantine-d6 Hydrochloride aids in understanding the drug’s absorption, distribution, metabolism, and excretion (ADME) profiles. This leads to better insights into its therapeutic effects and potential side effects, enhancing drug safety and efficacy.
Catalog Number | R004426 |
CAS Number | 1189713-18-5 |
Synonyms | 3,5-(Dimethyl-d6)tricyclo[3.3.1.13,7]decan-1-amine Hydrochloride; 3,5-(Dimethyl-d6)-1-adamantanamine; 1-Amino-3,5-(dimethyl-d6)adamantane Hydrochloride; Akatinol-d6; Axura-d6; Ebix-d6; Ebixia-d6; Ebixza-d6; NSC 102290-d6; Namenda-d6; SUN Y7017-d6; To |
Molecular Formula | C12H22ClN |
Purity | ≥95% |
Storage | Store at 4°C |
IUPAC Name | (3R,5S)-3,5-bis(trideuteriomethyl)adamantan-1-amine;hydrochloride |
InChI | InChI=1S/C12H21N.ClH/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;/h9H,3-8,13H2,1-2H3;1H/t9?,10-,11+,12?;/i1D3,2D3; |
InChIKey | LDDHMLJTFXJGPI-XJAKYWJYSA-N |
SMILES | [2H]C([2H])([2H])[C@]12CC3C[C@](C1)(CC(C3)(C2)N)C([2H])([2H])[2H].Cl |