For research use only. Not for therapeutic Use.
Menaquinone-5, commonly abbreviated as MK-5, is a form of vitamin K2 found in some animal products and fermented foods. Like other forms of vitamin K2, it contributes to various physiological processes, including blood clotting and bone metabolism. Research on menaquinone-5 explores its bioavailability, metabolic pathways, and potential health benefits, particularly its role in supporting cardiovascular health and bone density. Studies aim to elucidate its impact on human health and determine optimal dietary intake levels for overall well-being.
CAS Number | 1182-68-9 |
Synonyms | 2-Methyl-3-[(2E,6E,10E,14E)-3,7,11,15,19-pentamethyl-2,6,10,14,18-eicosapentaen-1-yl]-1,4-naphthalenedione; 2-Methyl-3-farnesylgeranyl-1,4-naphthoquinone; Menaquinone; Vitamin K2(25); Vitamin MK 5; |
Molecular Formula | C36H48O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methyl-3-[(2E,6E,10E,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenyl]naphthalene-1,4-dione |
InChI | InChI=1S/C36H48O2/c1-26(2)14-10-15-27(3)16-11-17-28(4)18-12-19-29(5)20-13-21-30(6)24-25-32-31(7)35(37)33-22-8-9-23-34(33)36(32)38/h8-9,14,16,18,20,22-24H,10-13,15,17,19,21,25H2,1-7H3/b27-16+,28-18+,29-20+,30-24+ |
InChIKey | HYPYXGZDOYTYDR-HAJWAVTHSA-N |
SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |