For research use only. Not for therapeutic Use.
Menaquinone-6, also known as MK-6, is a form of vitamin K2 found in various foods and synthesized by gut bacteria. It plays a crucial role in bone metabolism and cardiovascular health by participating in the carboxylation of osteocalcin and matrix Gla protein. Research on menaquinone-6 focuses on its bioavailability, physiological functions, and potential health benefits, particularly in preventing osteoporosis and reducing the risk of cardiovascular disease. Studies aim to elucidate its role in human health and optimize dietary intake recommendations.
CAS Number | 84-81-1 |
Synonyms | (all-E)-2-(3,7,11,15,19,23-Hexamethyl-2,6,10,14,18,22-tetracosahexaenyl)-3-methyl-1,4-naphthalenedione; Farnoquinone; MK6; Vitamin K2; Vitamin K2(30); Vitamin MK6; |
Molecular Formula | C41H56O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-3-methylnaphthalene-1,4-dione |
InChI | InChI=1S/C41H56O2/c1-30(2)16-11-17-31(3)18-12-19-32(4)20-13-21-33(5)22-14-23-34(6)24-15-25-35(7)28-29-37-36(8)40(42)38-26-9-10-27-39(38)41(37)43/h9-10,16,18,20,22,24,26-28H,11-15,17,19,21,23,25,29H2,1-8H3/b31-18+,32-20+,33-22+,34-24+,35-28+ |
InChIKey | PFRQBZFETXBLTP-RCIYGOBDSA-N |
SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |