For research use only. Not for therapeutic Use.
Menaquinone-7-13C6(Cat No.:S000558) is an isotopically labeled form of menaquinone-7, a subtype of vitamin K2 vital for bone health and cardiovascular function. The “13C6” notation indicates that six carbon atoms in the menaquinone-7 molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling facilitates precise tracking of menaquinone-7 metabolism and its incorporation into biological pathways using advanced analytical techniques like mass spectrometry. Menaquinone-7-13C6 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating diseases related to vitamin K deficiency or metabolism, such as osteoporosis and cardiovascular disease.
Catalog Number | S000558 |
Molecular Formula | C4013C6H64O2 |
Purity | ≥95% |
IUPAC Name | 2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-3-methylnaphthalene-1,4-dione |
InChI | InChI=1S/C46H64O2/c1-34(2)18-12-19-35(3)20-13-21-36(4)22-14-23-37(5)24-15-25-38(6)26-16-27-39(7)28-17-29-40(8)32-33-42-41(9)45(47)43-30-10-11-31-44(43)46(42)48/h10-11,18,20,22,24,26,28,30-32H,12-17,19,21,23,25,27,29,33H2,1-9H3/b35-20+,36-22+,37-24+,38-26+,39-28+,40-32+/i10+1,11+1,30+1,31+1,43+1,44+1 |
InChIKey | RAKQPZMEYJZGPI-MUMAHXDWSA-N |
SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |