For research use only. Not for therapeutic Use.
(+)-Menthol（Cat No.:R058480）is a naturally occurring compound derived from mint oils, primarily found in peppermint. It is a cyclic alcohol with a distinctive cooling and refreshing sensation, commonly used in pharmaceuticals, cosmetics, and food products. In pharmaceutical applications, (+)-menthol is used for its soothing properties in topical creams, ointments, and inhalants to relieve symptoms like muscle pain, congestion, and irritation. It also serves as a flavoring agent in food and beverages. Additionally, (+)-menthol is employed in personal care products like toothpaste and deodorants for its pleasant scent and cooling effect.
| CAS Number | 15356-60-2 |
| Synonyms | (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| Molecular Formula | C10H20O |
| Purity | ≥95% |
| IUPAC Name | (1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | NOOLISFMXDJSKH-AEJSXWLSSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@H](C1)O)C(C)C |
