For research use only. Not for therapeutic Use.
MeOSuc-Ala-Ala-Pro-Val-pNA（Cat No.:R029937）is a peptide substrate used in enzymatic assays to measure protease activity. It consists of a peptide sequence (Ala-Ala-Pro-Val) linked to a para-nitroanilide (pNA) group, which acts as a chromogenic reporter. The substrate is cleaved by specific proteases at the scissile bond between Pro-Val, releasing the pNA group. The liberated pNA produces a yellow color when exposed to a suitable pH, allowing for the quantification of protease activity. This substrate is commonly used in biochemical research for studying enzymes involved in protein degradation and processing.
| CAS Number | 70967-90-7 |
| Synonyms | methyl 4-[[(2S)-1-[[(2S)-1-[(2S)-2-[[(2S)-3-methyl-1-(4-nitroanilino)-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoate |
| Molecular Formula | C27H38N6O9 |
| Purity | ≥95% |
| IUPAC Name | methyl 4-[[(2S)-1-[[(2S)-1-[(2S)-2-[[(2S)-3-methyl-1-(4-nitroanilino)-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoate |
| InChI | InChI=1S/C27H38N6O9/c1-15(2)23(26(38)30-18-8-10-19(11-9-18)33(40)41)31-25(37)20-7-6-14-32(20)27(39)17(4)29-24(36)16(3)28-21(34)12-13-22(35)42-5/h8-11,15-17,20,23H,6-7,12-14H2,1-5H3,(H,28,34)(H,29,36)(H,30,38)(H,31,37)/t16-,17-,20-,23-/m0/s1 |
| InChIKey | VLVGCNNWNUERRZ-OSAZLGQLSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CCC(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
