For research use only. Not for therapeutic Use.
Mepazine hydrochloride(Cat No.:I012484)is a phenothiazine derivative with antipsychotic and sedative properties, historically used for managing psychiatric conditions such as schizophrenia and anxiety. By blocking dopamine receptors in the brain, it helps alleviate symptoms like agitation and delusions, contributing to mood stabilization. Additionally, mepazine exhibits antihistaminic effects, which enhance its sedative profile. Though now largely replaced by newer antipsychotics with fewer side effects, it remains valuable in pharmacological research, particularly for studying phenothiazine derivatives and their role in modulating central nervous system activity.
CAS Number | 2975-36-2 |
Synonyms | Pecazine hydrochloride; NSC-64076; 10-[(1-Methylpiperidin-3-yl)methyl]phenothiazine;hydrochloride |
Molecular Formula | C19H23ClN2S |
Purity | ≥95% |
Target | NF-κB |
IUPAC Name | 10-[(1-methylpiperidin-3-yl)methyl]phenothiazine;hydrochloride |
InChI | InChI=1S/C19H22N2S.ClH/c1-20-12-6-7-15(13-20)14-21-16-8-2-4-10-18(16)22-19-11-5-3-9-17(19)21;/h2-5,8-11,15H,6-7,12-14H2,1H3;1H |
InChIKey | RLCFKYRNUBRPIK-UHFFFAOYSA-N |
SMILES | CN1CCCC(C1)CN2C3=CC=CC=C3SC4=CC=CC=C42.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |