For research use only. Not for therapeutic Use.
Mercaptopentanone（Cat No.:M074939）, also known as 2-mercapto-3-pentanone, is an organic compound characterized by a five-carbon chain with a ketone functional group (C=O) at the third carbon and a thiol (SH) group at the second carbon. This compound exhibits a strong and pungent odor due to its thiol group. Mercaptopentanone finds application in organic synthesis as a building block for the preparation of various sulfur-containing compounds, such as thioesters and thiazoles. Additionally, it is utilized in flavor and fragrance formulations, contributing to the aroma of certain foods, beverages, and consumer products.
| Catalog Number | M074939 |
| CAS Number | 17042-24-9 |
| Molecular Formula | C5H10OS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-sulfanylpentan-3-one |
| InChI | InChI=1S/C5H10OS/c1-3-5(6)4(2)7/h4,7H,3H2,1-2H3 |
| InChIKey | TWOGJUHCCNLYPC-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(C)S |
