For research use only. Not for therapeutic Use.
Mersalyl（Cat No.:R025213）is an organomercury compound that acts as a potent inhibitor of enzymes involved in cellular processes, particularly those related to oxidative stress and inflammation. Historically, it was investigated for its potential therapeutic effects in treating conditions like hypertension and kidney diseases due to its ability to influence sodium and water retention. However, due to its mercury content, Mersalyl is largely avoided in clinical use because of its toxic side effects. It has also been studied in the context of protein inhibition and as a model compound in toxicology research.
| CAS Number | 492-18-2 |
| Synonyms | sodium;mercury(2+);2-[2-(2-methoxypropylcarbamoyl)phenoxy]acetate;hydroxide |
| Molecular Formula | C13H16HgNNaO6 |
| Purity | ≥95% |
| IUPAC Name | sodium;[3-[[2-(carboxylatomethoxy)benzoyl]amino]-2-methoxypropyl]mercury;hydrate |
| InChI | InChI=1S/C13H16NO5.Hg.Na.H2O/c1-9(18-2)7-14-13(17)10-5-3-4-6-11(10)19-8-12(15)16;;;/h3-6,9H,1,7-8H2,2H3,(H,14,17)(H,15,16);;;1H2/q;;+1;/p-1 |
| InChIKey | QGGPRJRKWYRGKR-UHFFFAOYSA-M |
| SMILES | COC(CNC(=O)C1=CC=CC=C1OCC(=O)[O-])C[Hg].O.[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
