For research use only. Not for therapeutic Use.
Mertansine, also known as DM1 (Cat No.:I001514), is a cytotoxic compound and a potent microtubule-disrupting agent. It is a derivative of maytansine, a natural compound originally isolated from the Maytenus genus of plants. Mertansine has shown significant anticancer activity and is used as a cytotoxic payload in antibody-drug conjugates (ADCs) for targeted cancer therapy. In ADCs, mertansine is conjugated to a monoclonal antibody that specifically recognizes and binds to cancer cells expressing a specific antigen. Upon binding, the ADC is internalized by the cancer cell, and mertansine is released, exerting its cytotoxic effect by disrupting microtubule formation and causing cell cycle arrest and apoptosis. Mertansine-based ADCs have been approved for the treatment of certain types of breast cancer and are being investigated for their efficacy against other malignancies as well.
| Catalog Number | I001514 |
| CAS Number | 139504-50-0 |
| Synonyms | DM 1 Compound |
| Molecular Formula | C35H48ClN3O10S |
| Purity | ≥95% |
| Target | microtubule inhibitor |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | [(1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] (2S)-2-[methyl(3-sulfanylpropanoyl)amino]propanoate |
| InChI | InChI=1S/C35H48ClN3O10S/c1-19-10-9-11-26(46-8)35(44)18-25(47-33(43)37-35)20(2)31-34(4,49-31)27(48-32(42)21(3)38(5)28(40)12-13-50)17-29(41)39(6)23-15-22(14-19)16-24(45-7)30(23)36/h9-11,15-16,20-21,25-27,31,44,50H,12-14,17-18H2,1-8H3,(H,37,43)/b11-9+,19-10+/t20-,21+,25+,26-,27+,31+,34+,35+/m1/s1 |
| InChIKey | ANZJBCHSOXCCRQ-FKUXLPTCSA-N |
| SMILES | C[C@@H]1[C@@H]2C[C@]([C@@H](/C=C/C=C(/CC3=CC(=C(C(=C3)OC)Cl)N(C(=O)C[C@@H]([C@]4([C@H]1O4)C)OC(=O)[C@H](C)N(C)C(=O)CCS)C)\C)OC)(NC(=O)O2)O |
| Reference | <br /> |
