For research use only. Not for therapeutic Use.
Mesaconitine（Cat No.:I002944） is an aconite alkaloid found in Aconiti tuber. It exhibits the ability to elevate intracellular calcium levels ([Ca2+]i) in endothelial cells. This effect is achieved through the influx of calcium ions from the extracellular space. Mesaconitine’s action on endothelial cells increases intracellular calcium concentration, potentially impacting various cellular processes and signaling pathways regulated by calcium.
| Catalog Number | I002944 |
| CAS Number | 2752-64-9 |
| Molecular Formula | C33H45NO11 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | 2-8°C(protect from light) |
| IUPAC Name | [(1S,2R,3R,4R,5R,6S,7S,8R,9R,13R,14R,16S,17S,18R)-8-acetyloxy-5,7,14-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
| InChI | InChI=1S/C33H45NO11/c1-16(35)45-33-21-18(13-31(39,28(43-6)26(33)37)27(21)44-29(38)17-10-8-7-9-11-17)32-20(41-4)12-19(36)30(15-40-3)14-34(2)25(32)22(33)23(42-5)24(30)32/h7-11,18-28,36-37,39H,12-15H2,1-6H3/t18-,19-,20+,21-,22+,23+,24-,25?,26+,27-,28+,30+,31-,32+,33-/m1/s1 |
| InChIKey | XUHJBXVYNBQQBD-TUWOXVOMSA-N |
| SMILES | CC(=O)OC12C3C(CC(C3OC(=O)C4=CC=CC=C4)(C(C1O)OC)O)C56C(CC(C7(C5C(C2C6N(C7)C)OC)COC)O)OC |
