For research use only. Not for therapeutic Use.
Mesalamine（Cat No.:A000823）is an anti-inflammatory drug widely used to treat inflammatory bowel diseases (IBD) such as ulcerative colitis and Crohn’s disease. It works by reducing inflammation in the colon, thereby alleviating symptoms like diarrhea, rectal bleeding, and abdominal pain. As a 5-aminosalicylic acid (5-ASA) derivative, Mesalamine targets the intestinal lining, providing localized treatment with fewer systemic side effects. Its high efficacy and safety profile make it a cornerstone in IBD management, offering relief and improving the quality of life for patients with chronic gastrointestinal conditions.
| Catalog Number | A000823 |
| CAS Number | 89-57-6 |
| Synonyms | 5-Aminosalicylic acid; Mesalamine; Mesalazine; 5-Amino-2-hydroxybenzoic acid; 89-57-6; Pentasa |
| Molecular Formula | C7H7NO3 |
| Purity | ≥95% |
| Target | PGE synthase |
| IUPAC Name | 5-amino-2-hydroxybenzoic acid |
| InChI | InChI=1S/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11) |
| InChIKey | KBOPZPXVLCULAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)O |
