For research use only. Not for therapeutic Use.
meso-Tetraphenylporphine is a synthetic porphyrin compound characterized by its four phenyl groups attached to the meso positions of the porphyrin ring. This structure makes it highly stable and useful in various scientific applications, including the study of light-harvesting systems, as a photosensitizer in photodynamic therapy, and in the development of organic semiconductors. Its ability to coordinate with metals further extends its utility in catalysis and materials science.
Catalog Number | R044229 |
CAS Number | 917-23-7 |
Synonyms | 5,10,15,20-Tetraphenyl-21H,23H-porphine; ?5,10,15,20-Tetraphenylporphine; α,β,γ,δ-Tetraphenylporphine; 5,10,15,20-Tetraphenyl-21H,23H-porphine; 5,10,15,20-Tetraphenyl-21H,23H-porphrin; 5,10,15,20-Tetraphenyl-21H,23H-porphyrin; |
Molecular Formula | C44H30N4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5,10,15,20-tetraphenyl-21,22-dihydroporphyrin |
InChI | InChI=1S/C44H30N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-28,45-46H |
InChIKey | AQPPOLXYUQPDOD-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=CC=C(N4)C(=C5C=CC(=N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C9=CC=CC=C9)N3 |