For research use only. Not for therapeutic Use.
Metaflumizone (Cat.No:R016900) is an insecticide used to control a wide range of pests, particularly in agricultural and horticultural applications. It works by selectively inhibiting sodium ion channels in the nervous systems of insects, disrupting nerve impulses and leading to paralysis and death. Metaflumizone is effective against pests such as mites, beetles, and caterpillars. Unlike some traditional insecticides, it has a lower toxicity to mammals and beneficial insects, making it a more environmentally friendly option for pest management.
CAS Number | 139968-49-3 |
Synonyms | NNI 0250; Altrevin; Alverde; BAS 320; BAS 32001; BAS 320021; BAS 320I; BASF 320; 2-[2-(4-Cyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]-N-[4-(trifluoromethoxy)phenyl]hydrazinecarboxamide |
Molecular Formula | C₂₄H₁₆F₆N₄O₂ |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | 1-[(E)-[2-(4-cyanophenyl)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]-3-[4-(trifluoromethoxy)phenyl]urea |
InChI | 1S/C24H16F6N4O2/c25-23(26,27)18-3-1-2-17(13-18)21(12-15-4-6-16(14-31)7-5-15)33-34-22(35)32-19-8-10-20(11-9-19)36-24(28,29)30/h1-11,13H,12H2,(H2,32,34,35)/b33-21+ |
InChIKey | MIFOMMKAVSCNKQ-QNKGDIEWSA-N |
SMILES | C1=CC(=CC(=C1)C(F)(F)F)/C(=N/NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)/CC3=CC=C(C=C3)C#N |