For research use only. Not for therapeutic Use.
MetAP2-IN-1(CAT: I040801) is a selective inhibitor of methionine aminopeptidase 2 (MetAP2), an enzyme involved in the removal of N-terminal methionine residues from nascent proteins. By inhibiting MetAP2, MetAP2-IN-1 can impede processes such as angiogenesis, making it a valuable tool for researching angiogenesis-mediated diseases. Studies have shown that MetAP2 inhibitors can effectively reduce weight in severely obese subjects by re-establishing insulin sensitivity and balancing fat metabolism. Additionally, MetAP2 inhibitors have been explored for their potential in cancer therapy due to their anti-angiogenic properties. MetAP2-IN-1 is suitable for research applications aimed at understanding the role of MetAP2 in various pathological conditions.
| CAS Number | 5301-98-4 |
| Synonyms | 4-(4-bromophenyl)-2H-triazole |
| Molecular Formula | C8H6BrN3 |
| Purity | ≥95% |
| IUPAC Name | 4-(4-bromophenyl)-2H-triazole |
| InChI | InChI=1S/C8H6BrN3/c9-7-3-1-6(2-4-7)8-5-10-12-11-8/h1-5H,(H,10,11,12) |
| InChIKey | RYKZCPFWGNDOQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNN=C2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
