For research use only. Not for therapeutic Use.
Metaraminol Tartrate(Cat No.:I003212)is a sympathomimetic agent primarily used to manage acute hypotension, particularly in cases of shock or during anesthesia. It acts by stimulating alpha-adrenergic receptors, leading to vasoconstriction and an increase in blood pressure. Additionally, Metaraminol Tartrate can induce the release of norepinephrine from nerve terminals, further enhancing its pressor effects. Its efficacy in rapidly elevating blood pressure makes it a valuable medication in emergency and surgical settings. Due to its reliable action and safety profile, Metaraminol Tartrate is essential for stabilizing patients with severe hypotensive episodes.
CAS Number | 33402-03-8 |
Molecular Formula | C13H19NO8 |
Purity | ≥95% |
Solubility | DMSO: ≥ 37 mg/mL |
Storage | Store at -20°C |
IUPAC Name | 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;(2R,3R)-2,3-dihydroxybutanedioic acid |
InChI | InChI=1S/C9H13NO2.C4H6O6/c1-6(10)9(12)7-3-2-4-8(11)5-7;5-1(3(7)8)2(6)4(9)10/h2-6,9,11-12H,10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t6-,9-;1-,2-/m01/s1 |
InChIKey | VENXSELNXQXCNT-IJYXXVHRSA-N |
SMILES | CC(C(C1=CC(=CC=C1)O)O)N.C(C(C(=O)O)O)(C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |