For research use only. Not for therapeutic Use.
Metformin hydrochloride（Cat No.:A000376）is an oral antihyperglycemic medication widely used in the management of type 2 diabetes mellitus. It works primarily by reducing hepatic glucose production, improving insulin sensitivity, and enhancing peripheral glucose uptake and utilization. Metformin is often the first-line treatment due to its efficacy, safety profile, and potential cardiovascular benefits. Additionally, it has shown promise in weight management and may have protective effects against certain cancers. Its mechanism of action involves the activation of AMP-activated protein kinase (AMPK), which plays a key role in metabolic regulation, further emphasizing its therapeutic significance.
| Catalog Number | A000376 |
| CAS Number | 1115-70-4 |
| Synonyms | NA |
| Molecular Formula | C4H11N5 • HCl |
| Purity | ≥95% |
| Target | AMPK |
| Storage | 3 years -20C powder |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;hydrochloride |
| InChI | InChI=1S/C4H11N5.ClH/c1-9(2)4(7)8-3(5)6;/h1-2H3,(H5,5,6,7,8);1H |
| InChIKey | OETHQSJEHLVLGH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=N)N=C(N)N.Cl |
| Reference | Kourelis, T. V., & Siegel, R. D. (2011). Metformin and cancer: New applications for an old drug. Medical Oncology, 29(2), 1314–1327. doi:10.1007/s12032-011-9846-7<br/><br/>Pawlyk AC, Giacomini KM, McKeon C, Shuldiner AR, Florez JC. Metformin Pharmacogenomics: Current Status and Future Directions. Diabetes. 2014;63(8):2590-2599. doi:10.2337/db13-1367.</span></p> |
