For research use only. Not for therapeutic Use.
Methacrylic acid sodium salt(CAT: R069504) is a chemical compound commonly used in the field of material chemistry and polymer science. Its action mechanism involves its role as a monomer in the synthesis of various polymers, including poly(methacrylic acid sodium salt) and its copolymers. These polymers exhibit excellent properties such as high transparency, water absorption capacity, and pH responsiveness, making them valuable in applications like drug delivery systems, coatings, and adhesives.
CAS Number | 5536-61-8 |
Molecular Formula | C4H5NaO2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | sodium;2-methylprop-2-enoate |
InChI | InChI=1S/C4H6O2.Na/c1-3(2)4(5)6;/h1H2,2H3,(H,5,6);/q;+1/p-1 |
InChIKey | SONHXMAHPHADTF-UHFFFAOYSA-M |
SMILES | CC(=C)C(=O)[O-].[Na+] |