For research use only. Not for therapeutic Use.
Methacryloxypropyl terminated polydimethylsiloxane (Cat No.:M094906) is a functionalized form of PDMS, a silicone-based polymer known for its flexibility, hydrophobicity, and thermal stability. The methacryloxypropyl group at the terminus introduces a reactive methacrylate functionality, allowing this polymer to bond with various substrates covalently or to participate in further polymerization processes. This modification is beneficial in materials science for creating hybrid organic-inorganic composites and coatings that benefit from the durable, flexible properties of PDMS and methacrylate’s reactive, adhesive qualities.
| Catalog Number | M094906 |
| CAS Number | 146632-07-7 |
| Molecular Formula | C12H26O4Si2 |
| Purity | ≥95% |
| Documentation | |
| Storage | Store at -20C |
| IUPAC Name | 3-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
| InChI | InChI=1S/C12H26O4Si2/c1-11(2)12(13)15-9-8-10-17(4,5)16-18(6,7)14-3/h1,8-10H2,2-7H3 |
| InChIKey | XKRNOHIEWSINLH-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)OC |
