For research use only. Not for therapeutic Use.
Methanone, (4-hydroxyphenyl)[4-(2-propyn-1-yloxy)phenyl]- (Cat.No:L003900) is a significant compound in organic chemistry. Its structure, incorporating a hydroxyphenyl and propynyl ether group, lends it unique reactivity. This compound finds applications as a key intermediate in the synthesis of specialized organic molecules. Its versatile nature and distinctive properties make it valuable in the development of innovative materials and pharmaceuticals.
CAS Number | 1208395-99-6 |
Molecular Formula | C16H12O3 |
Purity | ≥95% |
IUPAC Name | (4-hydroxyphenyl)-(4-prop-2-ynoxyphenyl)methanone |
InChI | InChI=1S/C16H12O3/c1-2-11-19-15-9-5-13(6-10-15)16(18)12-3-7-14(17)8-4-12/h1,3-10,17H,11H2 |
InChIKey | TZKIHDJSIXVMIQ-UHFFFAOYSA-N |
SMILES | C#CCOC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |