For research use only. Not for therapeutic Use.
Methdilazine(Cat No.:M121430)is an antihistamine medication used to treat allergic reactions, such as hay fever, urticaria, and other allergy symptoms. It belongs to the class of phenothiazines and works by blocking histamine receptors, reducing the effects of histamine in the body, which causes allergic symptoms. Methdilazine (200 mg) is typically used in controlled doses to manage symptoms like itching, runny nose, and sneezing. It may also have mild sedative properties. This medication is essential for treating allergic conditions and providing relief from discomfort caused by allergic reactions.
CAS Number | 1982-37-2 |
Molecular Formula | C18H20N2S |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | 10-[(1-methylpyrrolidin-3-yl)methyl]phenothiazine |
InChI | InChI=1S/C18H20N2S/c1-19-11-10-14(12-19)13-20-15-6-2-4-8-17(15)21-18-9-5-3-7-16(18)20/h2-9,14H,10-13H2,1H3 |
InChIKey | HTMIBDQKFHUPSX-UHFFFAOYSA-N |
SMILES | CN1CCC(C1)CN2C3=CC=CC=C3SC4=CC=CC=C42 |