For research use only. Not for therapeutic Use.
Methdilazine Hydrochloride(Cat No.:R049655)is a phenothiazine derivative and antihistamine widely used in pharmaceutical research. It acts as a selective antagonist of H1 histamine receptors, effectively reducing allergic reactions by inhibiting histamine-mediated responses. Methdilazine Hydrochloride is studied for its sedative and anticholinergic properties, which contribute to its therapeutic effects in managing allergies, hay fever, and urticaria. Additionally, it is explored for its potential applications in neuropharmacology due to its central nervous system activity. This compound is a valuable tool for advancing research in histamine-related disorders and therapeutic drug development.
CAS Number | 1229-35-2 |
Synonyms | 10-[(1-Methyl-3-pyrrolidinyl)methyl]-10H-phenothiazine Hydrochloride; Dilosyn; Disyncran; Methdilazine MonoHydrochloride; NSC 169091; Tacaryl; Tacaryl Hydrochloride; |
Molecular Formula | C18H21ClN2S |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | Desiccate at -80C |
IUPAC Name | 10-[(1-methylpyrrolidin-3-yl)methyl]phenothiazine;hydrochloride |
InChI | InChI=1S/C18H20N2S.ClH/c1-19-11-10-14(12-19)13-20-15-6-2-4-8-17(15)21-18-9-5-3-7-16(18)20;/h2-9,14H,10-13H2,1H3;1H |
InChIKey | IEISBKIVLDXSMZ-UHFFFAOYSA-N |
SMILES | CN1CCC(C1)CN2C3=CC=CC=C3SC4=CC=CC=C42.Cl |