For research use only. Not for therapeutic Use.
Methimazole-d3 is a deuterated form of methimazole, with three hydrogen atoms replaced by deuterium. This compound is commonly used in pharmacokinetic and metabolic studies to track the drug’s absorption, distribution, metabolism, and excretion with enhanced precision through techniques like mass spectrometry. Methimazole is an antithyroid agent that inhibits the synthesis of thyroid hormones by blocking the enzyme thyroid peroxidase, making it essential in the treatment of hyperthyroidism and Graves’ disease. The deuterium labeling in Methimazole-d3 ensures that the compound maintains its pharmacological properties while allowing for detailed analysis in research settings.
| Catalog Number | R006841 |
| CAS Number | 1160932-07-9 |
| Synonyms | 1,3-Dihydro-1-(methyl-d3)-2H-imidazole-2-thione; 1-Methylimidazole-d3-2-thiol; Mercazolyl-d3; Thiamazole-d3; Basolan-d3; Mercazole-d3; Metazolo-d3; Tapazole-d3 |
| Molecular Formula | C₄H₃D₃N₂S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(trideuteriomethyl)-1H-imidazole-2-thione |
| InChI | InChI=1S/C4H6N2S/c1-6-3-2-5-4(6)7/h2-3H,1H3,(H,5,7)/i1D3 |
| InChIKey | PMRYVIKBURPHAH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=CNC1=S |
