For research use only. Not for therapeutic Use.
Methost-7-enol（Cat No.:R037019), also known as Lophenol, is a naturally occurring sterol found in various plants and marine organisms. It is characterized by its unique chemical structure, featuring a hydroxyl group at the 3-position and a double bond at the 7-position in the sterol nucleus. Lophenol has garnered attention for its potential health benefits, including anti-inflammatory, antioxidant, and cholesterol-lowering properties. It plays a significant role in the study of phytosterols and their applications in nutraceuticals and pharmaceuticals, contributing to the development of natural therapies for chronic diseases and health maintenance.
| CAS Number | 481-25-4 |
| Synonyms | 4-Methylcholest-7-en-3-ol; 4alpha-Methyl-5alpha-cholest-7-en-3beta-ol. |
| Molecular Formula | C28H48O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3S,4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C28H48O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h10,18-20,22-26,29H,7-9,11-17H2,1-6H3/t19-,20+,22-,23+,24+,25+,26+,27-,28+/m1/s1 |
| InChIKey | LMYZQUNLYGJIHI-SPONXPENSA-N |
| SMILES | CC1C(CCC2(C1CC=C3C2CCC4(C3CCC4C(C)CCCC(C)C)C)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
