For research use only. Not for therapeutic Use.
Pyrroloquinoline quinone disodium salt (Cat No.:I000871) is a redox cofactor and an anionic redox-cycling proquinone. It was initially discovered in methylophilic bacteria cultures and is naturally found in mammalian tissues as well. PQQ is considered an essential nutrient for mammals and plays a crucial role in various biological processes, including immune function. It is involved in redox reactions and has been studied for its potential antioxidant and neuroprotective properties. PQQ’s presence in mammalian tissues suggests its importance in maintaining cellular health and overall immune function.
Catalog Number | I000871 |
CAS Number | 122628-50-6 |
Molecular Formula | C14H4N2Na2O8 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Solubility | 10 mM in H2O (free soluble) |
Storage | 2-8°C |
IUPAC Name | disodium;2-carboxy-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-7,9-dicarboxylate |
InChI | InChI=1S/C14H6N2O8.2Na/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18;;/h1-2,15H,(H,19,20)(H,21,22)(H,23,24);;/q;2*+1/p-2 |
InChIKey | UFVBOGYDCJNLPM-UHFFFAOYSA-L |
SMILES | C1=C(C2=C(C(=O)C(=O)C3=C2NC(=C3)C(=O)O)N=C1C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Reference | <p style=/line-height:25px/> <br>[2]. Bishop A, et al. Methoxatin (PQQ) in guinea-pig neutrophils. Free Radic Biol Med. 1994 Oct;17(4):311-20. </p> |