Home
>
Chemical Reagents> Methyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-YL)phenyl)cyclopropanecarboxylate
For research use only. Not for therapeutic Use.
Methyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanecarboxylate(Cat No.:L007358), is a significant chemical compound used in various research and pharmaceutical applications. Its molecular structure comprises a cyclopropane ring, a boron-containing phenyl group, and an ester functional group. This compound finds application in organic synthesis and medicinal chemistry, serving as a valuable building block in the development of biologically active molecules. Researchers use it to explore structure-activity relationships, design new drugs, and investigate potential treatments for various diseases. Compounds like Methyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl) cyclopropane carboxylate play a crucial role in advancing scientific knowledge and drug discovery efforts.
Catalog Number | L007358 |
CAS Number | 1396007-85-4 |
Molecular Formula | C17H23BO4 |
Purity | ≥95% |
IUPAC Name | methyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate |
InChI | InChI=1S/C17H23BO4/c1-15(2)16(3,4)22-18(21-15)13-8-6-12(7-9-13)17(10-11-17)14(19)20-5/h6-9H,10-11H2,1-5H3 |
InChIKey | XQQDYMOXTLWTIM-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CC3)C(=O)OC |