For research use only. Not for therapeutic Use.
Methyl 1-benzyl-1H-indole-5-carboxylate(Cat No.:L016759)is an essential intermediate in organic synthesis and pharmaceutical research. Featuring a benzyl-substituted indole core with a carboxylate ester group, this compound is pivotal in the development of various bioactive molecules, including potential drug candidates. Its structure allows for versatile chemical transformations, making it valuable in medicinal chemistry for the synthesis of complex heterocyclic compounds. High purity and consistent quality ensure reliable performance in research applications, supporting the advancement of innovative therapeutic agents and novel chemical entities.
CAS Number | 192997-32-3 |
Molecular Formula | C17H15NO2 |
Purity | ≥95% |
IUPAC Name | methyl 1-benzylindole-5-carboxylate |
InChI | InChI=1S/C17H15NO2/c1-20-17(19)15-7-8-16-14(11-15)9-10-18(16)12-13-5-3-2-4-6-13/h2-11H,12H2,1H3 |
InChIKey | MDQTVMUBQHOYBU-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC2=C(C=C1)N(C=C2)CC3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |