Home
>
Chemical Reagents>Heterocyclic Building Blocks> methyl 1-benzyl-3-hydroxy-1H-pyrrole-2-carboxylate
For research use only. Not for therapeutic Use.
Methyl 1-benzyl-3-hydroxy-1H-pyrrole-2-carboxylate(Cat No.:L007826), is a chemical compound with significant importance in medicinal chemistry and drug discovery. Its molecular structure comprises a pyrrole ring substituted with a benzyl group and a hydroxyethyl ester. This compound serves as a versatile intermediate in the synthesis of diverse organic molecules, including pharmaceuticals and bioactive compounds. Its reactivity and structural properties make it valuable for the development of potential drug candidates, aiding researchers in the exploration of novel therapeutic agents. Its role in custom synthesis contributes to advancements in pharmaceutical research and the development of innovative treatments.
CAS Number | 1782533-38-3 |
Molecular Formula | C13H13NO3 |
Purity | ≥95% |
IUPAC Name | methyl 1-benzyl-3-hydroxypyrrole-2-carboxylate |
InChI | InChI=1S/C13H13NO3/c1-17-13(16)12-11(15)7-8-14(12)9-10-5-3-2-4-6-10/h2-8,15H,9H2,1H3 |
InChIKey | ULIHNFNWZYJDMA-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=CN1CC2=CC=CC=C2)O |