For research use only. Not for therapeutic Use.
Methyl 1-cyanocyclobutanecarboxylate is an ester derived from cyclobutanecarboxylic acid, featuring a cyano group at the 1-position and a methyl ester group. This compound is a colorless liquid with potential applications in organic synthesis, particularly in the preparation of diverse cyclic compounds and pharmaceuticals. The presence of the cyano group enhances its reactivity, enabling further functionalization. Its unique structure makes it valuable in developing novel materials and investigating reaction mechanisms in chemical research.
| Catalog Number | L046023 |
| CAS Number | 58920-79-9 |
| Molecular Formula | C7H9NO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 1-cyanocyclobutane-1-carboxylate |
| InChI | InChI=1S/C7H9NO2/c1-10-6(9)7(5-8)3-2-4-7/h2-4H2,1H3 |
| InChIKey | WCTZTNWBOZFXTE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCC1)C#N |
