Home
>
Chemical Reagents>Heterocyclic Building Blocks> methyl 1-ethyl-4-nitro-1H-pyrazole-3-carboxylate
For research use only. Not for therapeutic Use.
Methyl 1-ethyl-4-nitro-1H-pyrazole-3-carboxylate(Cat No.:L021035)is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. This molecule features a pyrazole ring substituted with an ethyl group at the 1-position, a nitro group at the 4-position, and a methyl ester at the 3-position. It serves as a valuable intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations. Methyl 1-ethyl-4-nitro-1H-pyrazole-3-carboxylate is essential for precise synthetic applications in medicinal chemistry.
CAS Number | 923283-30-1 |
Molecular Formula | C7H9N3O4 |
Purity | ≥95% |
IUPAC Name | methyl 1-ethyl-4-nitropyrazole-3-carboxylate |
InChI | InChI=1S/C7H9N3O4/c1-3-9-4-5(10(12)13)6(8-9)7(11)14-2/h4H,3H2,1-2H3 |
InChIKey | HCXMLRVXGCCXIP-UHFFFAOYSA-N |
SMILES | CCN1C=C(C(=N1)C(=O)OC)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |