For research use only. Not for therapeutic Use.
Methyl 1-methyl-1H-indazole-4-carboxylate is a heterocyclic compound featuring a methyl group and a carboxylate ester at the 4-position of an indazole ring. This compound is notable in medicinal chemistry for its potential biological activities, including anti-inflammatory and antitumor effects. The methyl substitution enhances its lipophilicity, improving its ability to penetrate biological membranes. Its unique structure allows for further functionalization, making it a valuable scaffold for the development of novel therapeutic agents and applications in drug discovery.
CAS Number | 1071428-42-6 |
Molecular Formula | C10H10N2O2 |
Purity | ≥95% |
IUPAC Name | methyl 1-methylindazole-4-carboxylate |
InChI | InChI=1S/C10H10N2O2/c1-12-9-5-3-4-7(10(13)14-2)8(9)6-11-12/h3-6H,1-2H3 |
InChIKey | XSFSEOKZIRNPQO-UHFFFAOYSA-N |
SMILES | CN1C2=CC=CC(=C2C=N1)C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |