For research use only. Not for therapeutic Use.
Methyl 1,2,2,6,6-pentamethyl-4-piperidyl sebacate(CAT: M144205) is a chemical compound used primarily in the field of polymer chemistry and material science. This compound serves as a hindered amine light stabilizer (HALS) or UV stabilizer. HALS are additives incorporated into polymers and plastics to enhance their resistance to degradation caused by exposure to ultraviolet (UV) light. They play a crucial role in extending the lifespan and durability of plastic materials, such as those used in outdoor applications, like automotive components and outdoor furniture.
CAS Number | 82919-37-7 |
Synonyms | 82919-37-7; Methyl 1,2,2,6,6-pentamethyl-4-piperidyl sebacate; Decanedioic acid, methyl 1,2,2,6,6-pentamethyl-4-piperidinyl ester; Decanedioic acid, 1-methyl 10-(1,2,2,6,6-pentamethyl-4-piperidinyl) ester; UNII-47W9ZU9G0Y; EINECS 280-060-4 |
Molecular Formula | C21H39NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-O-methyl 10-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate |
InChI | InChI=1S/C21H39NO4/c1-20(2)15-17(16-21(3,4)22(20)5)26-19(24)14-12-10-8-7-9-11-13-18(23)25-6/h17H,7-16H2,1-6H3 |
InChIKey | OTCWVYFQGYOYJO-UHFFFAOYSA-N |
SMILES | CC1(CC(CC(N1C)(C)C)OC(=O)CCCCCCCCC(=O)OC)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |