For research use only. Not for therapeutic Use.
Methyl 2-(2-(5-chloro-2-phenoxyphenyl)-N-methylacetamido)acetate（Cat No.:I043094）is a specialized organic compound used in pharmaceutical and medicinal chemistry. It features a phenoxyphenyl group substituted with a chloro atom at the 5-position, along with an N-methylacetamido group, which provides reactivity for further chemical modifications. The compound also includes a methyl ester group, enhancing solubility and facilitating its incorporation into various synthetic pathways. This compound is utilized in the development of bioactive molecules, including peptide synthesis and drug design, where it can help create molecules with specific biological activity, such as targeting enzyme inhibition or receptor interactions.
| CAS Number | 1180843-76-8 |
| Synonyms | methyl 2-[[2-(5-chloro-2-phenoxyphenyl)acetyl]-methylamino]acetate |
| Molecular Formula | C18H18ClNO4 |
| Purity | ≥95% |
| IUPAC Name | methyl 2-[[2-(5-chloro-2-phenoxyphenyl)acetyl]-methylamino]acetate |
| InChI | InChI=1S/C18H18ClNO4/c1-20(12-18(22)23-2)17(21)11-13-10-14(19)8-9-16(13)24-15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3 |
| InChIKey | MHVBXDQYQMEQOP-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)OC)C(=O)CC1=C(C=CC(=C1)Cl)OC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
