Methyl 2-(2-Bromo-4-pyridyl)acetate

For research use only. Not for therapeutic Use.

  • CAT Number: L024322
  • CAS Number: 1234217-58-3
  • Molecular Formula: C8H8BrNO2
  • Molecular Weight: 230.06
  • Purity: ≥95%
Inquiry Now

Methyl 2-(2-Bromo-4-pyridyl)acetate(Cat No.:L024322)is a key intermediate in organic synthesis and pharmaceutical research. Featuring a brominated pyridine ring and an ester functional group, it is highly reactive and useful for the development of complex molecules. This compound is commonly employed in the synthesis of bioactive compounds, including potential therapeutic agents, due to its versatile structure. Its bromine atom enables further chemical transformations, such as cross-coupling reactions, while the ester group allows for easy modification. It plays a crucial role in drug discovery and medicinal chemistry applications.


CAS Number 1234217-58-3
Molecular Formula C8H8BrNO2
Purity ≥95%
IUPAC Name methyl 2-(2-bromopyridin-4-yl)acetate
InChI InChI=1S/C8H8BrNO2/c1-12-8(11)5-6-2-3-10-7(9)4-6/h2-4H,5H2,1H3
InChIKey UAFFLLDQVVGPDR-UHFFFAOYSA-N
SMILES COC(=O)CC1=CC(=NC=C1)Br

Request a Quote