For research use only. Not for therapeutic Use.
Methyl 2-(2-bromo-6-fluorophenyl)acetate(Cat No.:L026615)is a high-purity aromatic ester commonly used in pharmaceutical and chemical research. This compound features a bromine atom and a fluorine atom on a phenyl ring, attached to a methyl acetate group, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations, supporting the development of novel therapeutic agents. Methyl 2-(2-bromo-6-fluorophenyl)acetate is ideal for precise synthetic applications in medicinal chemistry and innovative research.
CAS Number | 1427397-15-6 |
Molecular Formula | C9H8BrFO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-(2-bromo-6-fluorophenyl)acetate |
InChI | InChI=1S/C9H8BrFO2/c1-13-9(12)5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3 |
InChIKey | QXIUUACWTNNJID-UHFFFAOYSA-N |
SMILES | COC(=O)CC1=C(C=CC=C1Br)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |