For research use only. Not for therapeutic Use.
Methyl 2-(2-chloropyridin-3-yl)acetate(CAT: L019049) is an organic compound that contains a pyridine ring substituted with a chlorine atom at the 2nd position and an acetate ester group at the 3rd position. The compound serves as a versatile intermediate in organic synthesis, particularly in the pharmaceutical and agrochemical industries. The ester group makes it useful for reactions such as ester hydrolysis or transesterification, while the chloropyridine moiety is commonly found in biologically active compounds. This structure is often utilized in the synthesis of more complex molecules, including potential drug candidates, due to its reactivity and ability to participate in various coupling and functionalization reactions.
CAS Number | 123222-09-3 |
Molecular Formula | C8H8ClNO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-(2-chloropyridin-3-yl)acetate |
InChI | InChI=1S/C8H8ClNO2/c1-12-7(11)5-6-3-2-4-10-8(6)9/h2-4H,5H2,1H3 |
InChIKey | HGRQGJYEMNWDFM-UHFFFAOYSA-N |