For research use only. Not for therapeutic Use.
Methyl 2-(3-amino-4-bromophenoxy)acetate is a brominated phenoxyacetate derivative with an amino group, commonly used as an intermediate in organic and medicinal chemistry. Its structure, featuring a bromine atom and amino functionality on the phenoxy ring, provides reactivity options for further modifications. This compound is valuable for synthesizing bioactive molecules, contributing to pharmaceutical development. Known for its stability and versatility, Methyl 2-(3-amino-4-bromophenoxy)acetate supports efficient pathways in producing complex compounds for drug discovery and other research applications.
CAS Number | 1387563-09-8 |
Molecular Formula | C9H10BrNO3 |
Purity | ≥95% |
IUPAC Name | methyl 2-(3-amino-4-bromophenoxy)acetate |
InChI | InChI=1S/C9H10BrNO3/c1-13-9(12)5-14-6-2-3-7(10)8(11)4-6/h2-4H,5,11H2,1H3 |
InChIKey | WSIBWCFDRDVWDV-UHFFFAOYSA-N |
SMILES | COC(=O)COC1=CC(=C(C=C1)Br)N |