Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> Methyl 2-(4-aminopiperidin-1-yl)nicotinate
For research use only. Not for therapeutic Use.
Methyl 2-(4-aminopiperidin-1-yl)nicotinate(Cat No.:L019182), is a chemical compound used in organic synthesis and pharmaceutical research. It is a nicotinate derivative with a methyl group attached to the nitrogen atom of a piperidine ring at the 2-position and an amino group at the 4-position. This compound serves as a valuable building block in the synthesis of various organic molecules and pharmaceutical agents. Its unique structure makes it useful for introducing specific functionalities, potentially enhancing biological activities or pharmacological properties.
CAS Number | 1185536-69-9 |
Molecular Formula | C12H17N3O2 |
Purity | ≥95% |
IUPAC Name | methyl 2-(4-aminopiperidin-1-yl)pyridine-3-carboxylate |
InChI | InChI=1S/C12H17N3O2/c1-17-12(16)10-3-2-6-14-11(10)15-7-4-9(13)5-8-15/h2-3,6,9H,4-5,7-8,13H2,1H3 |
InChIKey | DCIGJNGAFKSMDE-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(N=CC=C1)N2CCC(CC2)N |