For research use only. Not for therapeutic Use.
Methyl 2-(4-bromo-2-chloro-5-methylphenyl)acetate (Cat.No:L004188) is a crucial chemical compound with diverse applications. Its unique structure, featuring a bromo-chloro-methylphenyl acetate, grants it distinctive reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules with various industrial and pharmaceutical applications.
CAS Number | 1428761-26-5 |
Molecular Formula | C10H10BrClO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-(4-bromo-2-chloro-5-methylphenyl)acetate |
InChI | InChI=1S/C10H10BrClO2/c1-6-3-7(4-10(13)14-2)9(12)5-8(6)11/h3,5H,4H2,1-2H3 |
InChIKey | BVGLGRSNXOOBSX-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1Br)Cl)CC(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |