For research use only. Not for therapeutic Use.
Methyl 2-(4-tert-butylphenoxy)acetate is an aromatic ester commonly used as an intermediate in organic synthesis and pharmaceutical research. Featuring a tert-butyl-substituted phenoxy group attached to an acetate ester, this compound provides versatility in developing bioactive molecules and specialty chemicals. Its structure allows for diverse functional modifications, making it suitable for the synthesis of compounds targeting biological receptors. With stability and reactivity, it is valuable in medicinal chemistry for drug design and the production of complex organic frameworks.
CAS Number | 88530-52-3 |
Molecular Formula | C13H18O3 |
Purity | ≥95% |
IUPAC Name | methyl 2-(4-tert-butylphenoxy)acetate |
InChI | InChI=1S/C13H18O3/c1-13(2,3)10-5-7-11(8-6-10)16-9-12(14)15-4/h5-8H,9H2,1-4H3 |
InChIKey | OWLZIJMSCPKFJJ-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC=C(C=C1)OCC(=O)OC |