For research use only. Not for therapeutic Use.
Methyl 2-(5-bromo-2-chlorophenyl)acetate is an aromatic ester featuring a bromo and chloro-substituted phenyl group at the 2-position of an acetate moiety. This compound is significant in organic synthesis, serving as an intermediate in the development of various bioactive molecules. The presence of bromine and chlorine enhances its reactivity, facilitating cross-coupling reactions and further functionalization. Its unique structure allows for versatile modifications, making it valuable in the synthesis of pharmaceuticals and agrochemicals, as well as in chemical research applications.
CAS Number | 203314-33-4 |
Molecular Formula | C9H8BrClO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-(5-bromo-2-chlorophenyl)acetate |
InChI | InChI=1S/C9H8BrClO2/c1-13-9(12)5-6-4-7(10)2-3-8(6)11/h2-4H,5H2,1H3 |
InChIKey | GINLBXIFGQVBHL-UHFFFAOYSA-N |
SMILES | COC(=O)CC1=C(C=CC(=C1)Br)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |