For research use only. Not for therapeutic Use.
Methyl 2-(5-Bromo-2-nitrophenyl)acetate(Cat No.:L032398)is a crucial intermediate in organic synthesis, particularly in the development of pharmaceutical and agrochemical compounds. This brominated and nitro-substituted ester is widely used in creating bioactive molecules, offering potential applications in designing anti-inflammatory, antibacterial, and antifungal agents. Its structural features allow for versatile chemical transformations, making it a valuable component in medicinal chemistry research. With high purity and stability, this compound supports reliable and precise synthesis, aiding researchers in the discovery and optimization of new therapeutic and agrochemical products.
CAS Number | 189748-25-2 |
Molecular Formula | C9H8BrNO4 |
Purity | ≥95% |
IUPAC Name | methyl 2-(5-bromo-2-nitrophenyl)acetate |
InChI | InChI=1S/C9H8BrNO4/c1-15-9(12)5-6-4-7(10)2-3-8(6)11(13)14/h2-4H,5H2,1H3 |
InChIKey | MIXSLFKHFLGMNS-UHFFFAOYSA-N |
SMILES | COC(=O)CC1=C(C=CC(=C1)Br)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |