For research use only. Not for therapeutic Use.
Methyl 2-(5-Bromopyridin-2-yl)acetate(CAT: L031812) is a high-purity brominated pyridine derivative widely used in pharmaceutical and chemical research. Its unique structure, combining a bromopyridine ring and an ester group, makes it a valuable intermediate in the synthesis of bioactive compounds, agrochemicals, and advanced materials. This compound is particularly suited for applications in medicinal chemistry, enabling the development of enzyme inhibitors and receptor-targeting agents. With excellent reactivity and stability, Methyl 2-(5-Bromopyridin-2-yl)acetate offers reliable performance, ensuring precision and consistency in research projects focused on innovative drug discovery and synthetic chemistry.
CAS Number | 917023-06-4 |
Molecular Formula | C8H8BrNO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-(5-bromopyridin-2-yl)acetate |
InChI | InChI=1S/C8H8BrNO2/c1-12-8(11)4-7-3-2-6(9)5-10-7/h2-3,5H,4H2,1H3 |
InChIKey | NIAATLPQSKGUBG-UHFFFAOYSA-N |
SMILES | COC(=O)CC1=NC=C(C=C1)Br |