For research use only. Not for therapeutic Use.
Methyl 2-amino-2-(3-bromo-4-chlorophenyl)acetate hydrochloride (Cat.No:L004032) is a significant compound in pharmaceutical research. Its unique structure, featuring a bromochlorophenyl and an aminoacetate group, imparts distinctive reactivity and pharmacological potential. This compound is employed as a crucial intermediate in the synthesis of specialized pharmaceutical agents, highlighting its importance in drug development processes.
CAS Number | 2411634-43-8 |
Molecular Formula | C9H10BrCl2NO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-2-(3-bromo-4-chlorophenyl)acetate;hydrochloride |
InChI | InChI=1S/C9H9BrClNO2.ClH/c1-14-9(13)8(12)5-2-3-7(11)6(10)4-5;/h2-4,8H,12H2,1H3;1H |
InChIKey | RLVQJYRIUJDJKL-UHFFFAOYSA-N |
SMILES | COC(=O)C(C1=CC(=C(C=C1)Cl)Br)N.Cl |