Home
>
Chemical Reagents>Organic Building Blocks> Methyl 2-amino-2-(3,4-dichlorophenyl)acetate hydrochloride
For research use only. Not for therapeutic Use.
Methyl 2-amino-2-(3,4-dichlorophenyl)acetate hydrochloride(Cat No.:L031112)is a chemical compound widely used in pharmaceutical research and organic synthesis. Featuring a dichlorophenyl group attached to an aminoacetate backbone, this compound serves as a key intermediate in the development of various bioactive molecules, including potential therapeutic agents. The hydrochloride salt form enhances its solubility and stability, making it suitable for diverse experimental applications. This compound is particularly valuable in synthesizing complex organic molecules, contributing to advancements in drug discovery and the development of new chemical entities in medicinal chemistry.
CAS Number | 1078611-21-8 |
Molecular Formula | C9H10Cl3NO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-2-(3,4-dichlorophenyl)acetate;hydrochloride |
InChI | InChI=1S/C9H9Cl2NO2.ClH/c1-14-9(13)8(12)5-2-3-6(10)7(11)4-5;/h2-4,8H,12H2,1H3;1H |
InChIKey | SRIJGMLHUNVNAI-UHFFFAOYSA-N |
SMILES | COC(=O)C(C1=CC(=C(C=C1)Cl)Cl)N.Cl |