For research use only. Not for therapeutic Use.
Methyl 2-amino-3-chloro-5-(trifluoromethoxy)benzoate is a chemical compound featuring a benzoate structure with an amino group at the second position and a chloro group at the third position. The trifluoromethoxy group at the fifth position enhances its chemical properties, potentially affecting its reactivity and biological activity. This compound is of interest in pharmaceutical research, particularly for its potential applications in drug development and synthesis. Its unique structure may contribute to novel therapeutic effects in medicinal chemistry.
CAS Number | 1003708-08-4 |
Molecular Formula | C9H7ClF3NO3 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-3-chloro-5-(trifluoromethoxy)benzoate |
InChI | InChI=1S/C9H7ClF3NO3/c1-16-8(15)5-2-4(17-9(11,12)13)3-6(10)7(5)14/h2-3H,14H2,1H3 |
InChIKey | FLUHLRSUIMWSLN-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C(=CC(=C1)OC(F)(F)F)Cl)N |