For research use only. Not for therapeutic Use.
Methyl 2-amino-3-chloropropanoate hydrochloride(Cat No.:R002612)is a chemical compound often used in organic synthesis and biochemical research. It consists of an amino acid derivative with a chlorine atom attached to the carbon chain, making it valuable for creating more complex molecules. This compound is typically employed in the preparation of various peptides and pharmaceuticals, and can also serve as an intermediate in drug discovery processes. Its unique structure makes it useful for studying enzyme interactions and for designing new molecules with potential therapeutic applications in areas like cancer or inflammation research.
CAS Number | 33646-31-0 |
Synonyms | methyl 2-amino-3-chloropropanoate;hydrochloride |
Molecular Formula | C4H9Cl2NO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-3-chloropropanoate;hydrochloride |
InChI | InChI=1S/C4H8ClNO2.ClH/c1-8-4(7)3(6)2-5;/h3H,2,6H2,1H3;1H |
InChIKey | POPBCSXDEXRDSX-UHFFFAOYSA-N |
SMILES | COC(=O)C(CCl)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |