For research use only. Not for therapeutic Use.
Methyl 2-amino-3,6-difluorobenzoate(Cat No.:L044219)is a fluorinated aromatic ester featuring an amino group at the 2-position and fluorine atoms at the 3 and 6 positions on the benzene ring. This compound is widely used in pharmaceutical research and organic synthesis as a key intermediate for the development of bioactive molecules, including drug candidates. The combination of amino and fluorine groups enhances the compound’s reactivity and potential for diverse chemical modifications. Its ester functionality allows for further derivatization, making it valuable in medicinal chemistry and advanced chemical synthesis.
CAS Number | 1184204-30-5 |
Molecular Formula | C8H7F2NO2 |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-3,6-difluorobenzoate |
InChI | InChI=1S/C8H7F2NO2/c1-13-8(12)6-4(9)2-3-5(10)7(6)11/h2-3H,11H2,1H3 |
InChIKey | SWVGSVMHUSBITN-UHFFFAOYSA-N |
SMILES | COC(=O)C1=C(C=CC(=C1N)F)F |